C20H25N3 — CID 142584289
7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]-N-prop-1-en-2-ylquinazolin-2-amine (PubChem CID 142584289) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]-N-prop-1-en-2-ylquinazolin-2-amine.
| Compound Name | 7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]-N-prop-1-en-2-ylquinazolin-2-amine |
|---|---|
| PubChem CID | 142584289 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]-N-prop-1-en-2-ylquinazolin-2-amine |
| SMILES | C=C(C)Nc1ncc2ccc(/C(=C/C)C/C(C)=C/CC)cc2n1 |
| InChI | InChI=1S/C20H25N3/c1-6-8-15(5)11-16(7-2)17-9-10-18-13-21-20(22-14(3)4)23-19(18)12-17/h7-10,12-13H,3,6,11H2,1-2,4-5H3,(H,21,22,23)/b15-8+,16-7+ |
| InChIKey | DROILATYNQETJM-ANSQBLEFSA-N |
| XLogP | 5.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|