C11H13N3S — CID 155032361
N-[(E)-pent-2-en-2-yl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 155032361) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(E)-pent-2-en-2-yl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | N-[(E)-pent-2-en-2-yl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155032361 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[(E)-pent-2-en-2-yl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CC/C=C(\C)Nc1ncc2sccc2n1 |
| InChI | InChI=1S/C11H13N3S/c1-3-4-8(2)13-11-12-7-10-9(14-11)5-6-15-10/h4-7H,3H2,1-2H3,(H,12,13,14)/b8-4+ |
| InChIKey | NLOUVUBJIIIXNW-XBXARRHUSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |