C6H3FN2S — CID 155821803
2-fluorothieno[3,2-d]pyrimidine (PubChem CID 155821803) has the molecular formula C6H3FN2S and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-fluorothieno[3,2-d]pyrimidine.
| Compound Name | 2-fluorothieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155821803 |
| Molecular Formula | C6H3FN2S |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 2-fluorothieno[3,2-d]pyrimidine |
| SMILES | Fc1ncc2sccc2n1 |
| InChI | InChI=1S/C6H3FN2S/c7-6-8-3-5-4(9-6)1-2-10-5/h1-3H |
| InChIKey | KUKHYZRTBYHFMG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |