C7H7N3S — CID 82414555
thieno[3,2-d]pyrimidin-2-ylmethanamine (PubChem CID 82414555) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is thieno[3,2-d]pyrimidin-2-ylmethanamine.
| Compound Name | thieno[3,2-d]pyrimidin-2-ylmethanamine |
|---|---|
| PubChem CID | 82414555 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | thieno[3,2-d]pyrimidin-2-ylmethanamine |
| SMILES | NCc1ncc2sccc2n1 |
| InChI | InChI=1S/C7H7N3S/c8-3-7-9-4-6-5(10-7)1-2-11-6/h1-2,4H,3,8H2 |
| InChIKey | KZNSCSBJUMVLRR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |