About N-pyrido[3,4-d]pyrimidin-2-ylacetamide
N-pyrido[3,4-d]pyrimidin-2-ylacetamide (PubChem CID 67452729) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is N-pyrido[3,4-d]pyrimidin-2-ylacetamide.
Molecular Properties
| Compound Name | N-pyrido[3,4-d]pyrimidin-2-ylacetamide |
| PubChem CID | 67452729 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | N-pyrido[3,4-d]pyrimidin-2-ylacetamide |
| SMILES | CC(=O)Nc1ncc2ccncc2n1 |
| InChI | InChI=1S/C9H8N4O/c1-6(14)12-9-11-4-7-2-3-10-5-8(7)13-9/h2-5H,1H3,(H,11,12,13,14) |
| InChIKey | KAQJPQZKYAZMIU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-pyrido[3,4-d]pyrimidin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrido[3,4-d]pyrimidin-2-ylacetamide?
The IUPAC name of N-pyrido[3,4-d]pyrimidin-2-ylacetamide (CID 67452729) is N-pyrido[3,4-d]pyrimidin-2-ylacetamide.
What is the SMILES notation for N-pyrido[3,4-d]pyrimidin-2-ylacetamide?
The canonical SMILES for N-pyrido[3,4-d]pyrimidin-2-ylacetamide is CC(=O)Nc1ncc2ccncc2n1.
What is the InChIKey of N-pyrido[3,4-d]pyrimidin-2-ylacetamide?
The InChIKey is KAQJPQZKYAZMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c1-6(14)12-9-11-4-7-2-3-10-5-8(7)13-9/h2-5H,1H3,(H,11,12,13,14).
What are the key properties of N-pyrido[3,4-d]pyrimidin-2-ylacetamide?
N-pyrido[3,4-d]pyrimidin-2-ylacetamide has a molecular weight of 188.19 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrido[3,4-d]pyrimidin-2-ylacetamide is sourced from PubChem (CID 67452729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).