C9H7N3O — CID 84654616
1-pyrido[3,4-b]pyrazin-3-ylethanone (PubChem CID 84654616) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is 1-pyrido[3,4-b]pyrazin-3-ylethanone.
| Compound Name | 1-pyrido[3,4-b]pyrazin-3-ylethanone |
|---|---|
| PubChem CID | 84654616 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 1-pyrido[3,4-b]pyrazin-3-ylethanone |
| SMILES | CC(=O)c1cnc2ccncc2n1 |
| InChI | InChI=1S/C9H7N3O/c1-6(13)8-5-11-7-2-3-10-4-9(7)12-8/h2-5H,1H3 |
| InChIKey | NKIRNBKHWKYRMF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |