About 1,6-naphthyridine-2-carboxylic acid;hydrochloride
1,6-naphthyridine-2-carboxylic acid;hydrochloride (PubChem CID 170943375) has the molecular formula C9H7ClN2O2
and a molecular weight of 210.62 g/mol. Its IUPAC name is 1,6-naphthyridine-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1,6-naphthyridine-2-carboxylic acid;hydrochloride |
| PubChem CID | 170943375 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1,6-naphthyridine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc2cnccc2n1 |
| InChI | InChI=1S/C9H6N2O2.ClH/c12-9(13)8-2-1-6-5-10-4-3-7(6)11-8;/h1-5H,(H,12,13);1H |
| InChIKey | GVMOASLSDILEQA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-naphthyridine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-naphthyridine-2-carboxylic acid;hydrochloride?
The IUPAC name of 1,6-naphthyridine-2-carboxylic acid;hydrochloride (CID 170943375) is 1,6-naphthyridine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,6-naphthyridine-2-carboxylic acid;hydrochloride?
The canonical SMILES for 1,6-naphthyridine-2-carboxylic acid;hydrochloride is Cl.O=C(O)c1ccc2cnccc2n1.
What is the InChIKey of 1,6-naphthyridine-2-carboxylic acid;hydrochloride?
The InChIKey is GVMOASLSDILEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.ClH/c12-9(13)8-2-1-6-5-10-4-3-7(6)11-8;/h1-5H,(H,12,13);1H.
What are the key properties of 1,6-naphthyridine-2-carboxylic acid;hydrochloride?
1,6-naphthyridine-2-carboxylic acid;hydrochloride has a molecular weight of 210.62 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-naphthyridine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 170943375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).