C16H13N5O — CID 26974464
N-[(Z)-1-quinoxalin-2-ylethylideneamino]pyridine-4-carboxamide (PubChem CID 26974464) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[(Z)-1-quinoxalin-2-ylethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-1-quinoxalin-2-ylethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 26974464 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(Z)-1-quinoxalin-2-ylethylideneamino]pyridine-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccncc1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H13N5O/c1-11(20-21-16(22)12-6-8-17-9-7-12)15-10-18-13-4-2-3-5-14(13)19-15/h2-10H,1H3,(H,21,22)/b20-11- |
| InChIKey | NEWRDSLKWALODT-JAIQZWGSSA-N |
| XLogP | 2.18 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|