About pyrido[3,4-b]pyrazine-2-carbaldehyde
pyrido[3,4-b]pyrazine-2-carbaldehyde (PubChem CID 151212996) has the molecular formula C8H5N3O
and a molecular weight of 159.15 g/mol. Its IUPAC name is pyrido[3,4-b]pyrazine-2-carbaldehyde.
Molecular Properties
| Compound Name | pyrido[3,4-b]pyrazine-2-carbaldehyde |
| PubChem CID | 151212996 |
| Molecular Formula | C8H5N3O |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | pyrido[3,4-b]pyrazine-2-carbaldehyde |
| SMILES | O=Cc1cnc2cnccc2n1 |
| InChI | InChI=1S/C8H5N3O/c12-5-6-3-10-8-4-9-2-1-7(8)11-6/h1-5H |
| InChIKey | NKQYTUJFEPCUAJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze pyrido[3,4-b]pyrazine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,4-b]pyrazine-2-carbaldehyde?
The IUPAC name of pyrido[3,4-b]pyrazine-2-carbaldehyde (CID 151212996) is pyrido[3,4-b]pyrazine-2-carbaldehyde.
What is the SMILES notation for pyrido[3,4-b]pyrazine-2-carbaldehyde?
The canonical SMILES for pyrido[3,4-b]pyrazine-2-carbaldehyde is O=Cc1cnc2cnccc2n1.
What is the InChIKey of pyrido[3,4-b]pyrazine-2-carbaldehyde?
The InChIKey is NKQYTUJFEPCUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O/c12-5-6-3-10-8-4-9-2-1-7(8)11-6/h1-5H.
What are the key properties of pyrido[3,4-b]pyrazine-2-carbaldehyde?
pyrido[3,4-b]pyrazine-2-carbaldehyde has a molecular weight of 159.15 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,4-b]pyrazine-2-carbaldehyde is sourced from PubChem (CID 151212996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).