C10H6N2O3 — CID 142031110
[1,3]dioxolo[4,5-h]quinoxaline-8-carbaldehyde (PubChem CID 142031110) has the molecular formula C10H6N2O3 and a molecular weight of 202.17 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-h]quinoxaline-8-carbaldehyde.
| Compound Name | [1,3]dioxolo[4,5-h]quinoxaline-8-carbaldehyde |
|---|---|
| PubChem CID | 142031110 |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | [1,3]dioxolo[4,5-h]quinoxaline-8-carbaldehyde |
| SMILES | O=Cc1cnc2ccc3c(c2n1)OCO3 |
| InChI | InChI=1S/C10H6N2O3/c13-4-6-3-11-7-1-2-8-10(9(7)12-6)15-5-14-8/h1-4H,5H2 |
| InChIKey | VGDGIHLOTUMQMH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|