C26H38N4O2 — CID 142583531
N-[7-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]quinazolin-2-yl]formamide;N,N,4-trimethylcyclohexan-1-amine (PubChem CID 142583531) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[7-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]quinazolin-2-yl]formamide;N,N,4-trimethylcyclohexan-1-amine.
| Compound Name | N-[7-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]quinazolin-2-yl]formamide;N,N,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142583531 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | N-[7-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]quinazolin-2-yl]formamide;N,N,4-trimethylcyclohexan-1-amine |
| SMILES | C/C=C(\O/C(C)=C/CC)c1ccc2cnc(NC=O)nc2c1.CC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C17H19N3O2.C9H19N/c1-4-6-12(3)22-16(5-2)13-7-8-14-10-18-17(19-11-21)20-15(14)9-13;1-8-4-6-9(7-5-8)10(2)3/h5-11H,4H2,1-3H3,(H,18,19,20,21);8-9H,4-7H2,1-3H3/b12-6+,16-5-; |
| InChIKey | QWAKHAIUKMOPSV-RVLZLYBGSA-N |
| XLogP | 6.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|