C18H21N3O2 — CID 142584586
N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]acetamide (PubChem CID 142584586) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]acetamide.
| Compound Name | N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]acetamide |
|---|---|
| PubChem CID | 142584586 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]acetamide |
| SMILES | C/C=C(\O/C(C)=C/CC)c1ccc2cnc(NC(C)=O)cc2n1 |
| InChI | InChI=1S/C18H21N3O2/c1-5-7-12(3)23-17(6-2)15-9-8-14-11-19-18(20-13(4)22)10-16(14)21-15/h6-11H,5H2,1-4H3,(H,19,20,22)/b12-7+,17-6- |
| InChIKey | KNTFZVHQLMICDF-YUJAFTAOSA-N |
| XLogP | 4.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|