C27H31N5O2 — CID 142584352
N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]-2-piperidin-1-ylpyridine-4-carboxamide (PubChem CID 142584352) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]-2-piperidin-1-ylpyridine-4-carboxamide.
| Compound Name | N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]-2-piperidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 142584352 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[2-[(Z)-1-[(E)-pent-2-en-2-yl]oxyprop-1-enyl]-1,6-naphthyridin-7-yl]-2-piperidin-1-ylpyridine-4-carboxamide |
| SMILES | C/C=C(\O/C(C)=C/CC)c1ccc2cnc(NC(=O)c3ccnc(N4CCCCC4)c3)cc2n1 |
| InChI | InChI=1S/C27H31N5O2/c1-4-9-19(3)34-24(5-2)22-11-10-21-18-29-25(17-23(21)30-22)31-27(33)20-12-13-28-26(16-20)32-14-7-6-8-15-32/h5,9-13,16-18H,4,6-8,14-15H2,1-3H3,(H,29,31,33)/b19-9+,24-5- |
| InChIKey | YVAMAEOPYQUBQW-CWQGDYTASA-N |
| XLogP | 5.96 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|