C25H37N5O2 — CID 166940299
(E)-3-ethyl-2-[[2-(1-hydroxy-1-piperidin-4-ylethyl)-1,6-naphthyridin-7-yl]amino]-N,2-dimethylhex-3-enamide (PubChem CID 166940299) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is (E)-3-ethyl-2-[[2-(1-hydroxy-1-piperidin-4-ylethyl)-1,6-naphthyridin-7-yl]amino]-N,2-dimethylhex-3-enamide.
| Compound Name | (E)-3-ethyl-2-[[2-(1-hydroxy-1-piperidin-4-ylethyl)-1,6-naphthyridin-7-yl]amino]-N,2-dimethylhex-3-enamide |
|---|---|
| PubChem CID | 166940299 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | (E)-3-ethyl-2-[[2-(1-hydroxy-1-piperidin-4-ylethyl)-1,6-naphthyridin-7-yl]amino]-N,2-dimethylhex-3-enamide |
| SMILES | CC/C=C(\CC)C(C)(Nc1cc2nc(C(C)(O)C3CCNCC3)ccc2cn1)C(=O)NC |
| InChI | InChI=1S/C25H37N5O2/c1-6-8-18(7-2)24(3,23(31)26-5)30-22-15-20-17(16-28-22)9-10-21(29-20)25(4,32)19-11-13-27-14-12-19/h8-10,15-16,19,27,32H,6-7,11-14H2,1-5H3,(H,26,31)(H,28,30)/b18-8+ |
| InChIKey | XWUZCRMROMOTAT-QGMBQPNBSA-N |
| XLogP | 3.50 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|