C17H23N — CID 137400657
3-[(E)-5-methylidenehept-2-en-3-yl]-N-prop-1-en-2-ylaniline (PubChem CID 137400657) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 3-[(E)-5-methylidenehept-2-en-3-yl]-N-prop-1-en-2-ylaniline.
| Compound Name | 3-[(E)-5-methylidenehept-2-en-3-yl]-N-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 137400657 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3-[(E)-5-methylidenehept-2-en-3-yl]-N-prop-1-en-2-ylaniline |
| SMILES | C=C(CC)C/C(=C\C)c1cccc(NC(=C)C)c1 |
| InChI | InChI=1S/C17H23N/c1-6-14(5)11-15(7-2)16-9-8-10-17(12-16)18-13(3)4/h7-10,12,18H,3,5-6,11H2,1-2,4H3/b15-7+ |
| InChIKey | COXJKJGTLBUXET-VIZOYTHASA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|