C29H44N2O2 — CID 143712265
N,N-dimethylpropan-1-amine;(2Z,4Z,7Z)-5-(1-methoxyethenyl)-6-methylidenenona-2,4,7-triene;1-[3-(prop-1-en-2-ylamino)phenyl]ethanone (PubChem CID 143712265) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;(2Z,4Z,7Z)-5-(1-methoxyethenyl)-6-methylidenenona-2,4,7-triene;1-[3-(prop-1-en-2-ylamino)phenyl]ethanone.
| Compound Name | N,N-dimethylpropan-1-amine;(2Z,4Z,7Z)-5-(1-methoxyethenyl)-6-methylidenenona-2,4,7-triene;1-[3-(prop-1-en-2-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 143712265 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | N,N-dimethylpropan-1-amine;(2Z,4Z,7Z)-5-(1-methoxyethenyl)-6-methylidenenona-2,4,7-triene;1-[3-(prop-1-en-2-ylamino)phenyl]ethanone |
| SMILES | C=C(/C=C\C)/C(=C/C=C\C)C(=C)OC.C=C(C)Nc1cccc(C(C)=O)c1.CCCN(C)C |
| InChI | InChI=1S/C13H18O.C11H13NO.C5H13N/c1-6-8-10-13(12(4)14-5)11(3)9-7-2;1-8(2)12-11-6-4-5-10(7-11)9(3)13;1-4-5-6(2)3/h6-10H,3-4H2,1-2,5H3;4-7,12H,1H2,2-3H3;4-5H2,1-3H3/b8-6-,9-7-,13-10-;; |
| InChIKey | JUQFYYVMGMGNSF-RCXAKHAZSA-N |
| XLogP | 7.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|