C15H21N3O3 — CID 108943910
N'-(3-acetylphenyl)-N-[2-(dimethylamino)ethyl]propanediamide (PubChem CID 108943910) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-[2-(dimethylamino)ethyl]propanediamide.
| Compound Name | N'-(3-acetylphenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
|---|---|
| PubChem CID | 108943910 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N'-(3-acetylphenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-11(19)12-5-4-6-13(9-12)17-15(21)10-14(20)16-7-8-18(2)3/h4-6,9H,7-8,10H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | UASVYONPCDTRDE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|