C13H18N2O4 — CID 61347604
3-(3-acetylphenyl)-1,1-bis(2-hydroxyethyl)urea (PubChem CID 61347604) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1,1-bis(2-hydroxyethyl)urea.
| Compound Name | 3-(3-acetylphenyl)-1,1-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 61347604 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-(3-acetylphenyl)-1,1-bis(2-hydroxyethyl)urea |
| SMILES | CC(=O)c1cccc(NC(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-10(18)11-3-2-4-12(9-11)14-13(19)15(5-7-16)6-8-17/h2-4,9,16-17H,5-8H2,1H3,(H,14,19) |
| InChIKey | QRAHMKZMIBKUCO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |