C11H10FN3O3 — CID 167978058
(2S)-2-[(7-fluoroquinazolin-2-yl)amino]-3-hydroxypropanoic acid (PubChem CID 167978058) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is (2S)-2-[(7-fluoroquinazolin-2-yl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(7-fluoroquinazolin-2-yl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 167978058 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (2S)-2-[(7-fluoroquinazolin-2-yl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](CO)Nc1ncc2ccc(F)cc2n1 |
| InChI | InChI=1S/C11H10FN3O3/c12-7-2-1-6-4-13-11(14-8(6)3-7)15-9(5-16)10(17)18/h1-4,9,16H,5H2,(H,17,18)(H,13,14,15)/t9-/m0/s1 |
| InChIKey | RZZOHDFJGQPWSP-VIFPVBQESA-N |
| XLogP | 0.63 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |