C15H17FN2O2 — CID 122050140
(2S)-2-[(7-fluoroquinolin-2-yl)amino]-4-methylpentanoic acid (PubChem CID 122050140) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is (2S)-2-[(7-fluoroquinolin-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(7-fluoroquinolin-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122050140 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2S)-2-[(7-fluoroquinolin-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](Nc1ccc2ccc(F)cc2n1)C(=O)O |
| InChI | InChI=1S/C15H17FN2O2/c1-9(2)7-13(15(19)20)18-14-6-4-10-3-5-11(16)8-12(10)17-14/h3-6,8-9,13H,7H2,1-2H3,(H,17,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | SJZOGQJIUNCGGA-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |