C11H15FN2O2 — CID 120964579
(2S)-2-[(5-fluoro-2-pyridinyl)amino]-4-methylpentanoic acid (PubChem CID 120964579) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is (2S)-2-[(5-fluoro-2-pyridinyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(5-fluoro-2-pyridinyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120964579 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2S)-2-[(5-fluoro-2-pyridinyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](Nc1ccc(F)cn1)C(=O)O |
| InChI | InChI=1S/C11H15FN2O2/c1-7(2)5-9(11(15)16)14-10-4-3-8(12)6-13-10/h3-4,6-7,9H,5H2,1-2H3,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | REOKADREWPPDCM-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |