C15H23N3O4 — CID 122062569
2-[[5-(2-methoxyethylcarbamoyl)-2-pyridinyl]amino]-4-methylpentanoic acid (PubChem CID 122062569) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[5-(2-methoxyethylcarbamoyl)-2-pyridinyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(2-methoxyethylcarbamoyl)-2-pyridinyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122062569 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[[5-(2-methoxyethylcarbamoyl)-2-pyridinyl]amino]-4-methylpentanoic acid |
| SMILES | COCCNC(=O)c1ccc(NC(CC(C)C)C(=O)O)nc1 |
| InChI | InChI=1S/C15H23N3O4/c1-10(2)8-12(15(20)21)18-13-5-4-11(9-17-13)14(19)16-6-7-22-3/h4-5,9-10,12H,6-8H2,1-3H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | CXIDKIBAUAHWBB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|