C15H23N3O3 — CID 133495372
6-[[(1S,2S)-2-hydroxycyclohexyl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 133495372) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-[[(1S,2S)-2-hydroxycyclohexyl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[[(1S,2S)-2-hydroxycyclohexyl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133495372 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 6-[[(1S,2S)-2-hydroxycyclohexyl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(N[C@H]2CCCC[C@@H]2O)nc1 |
| InChI | InChI=1S/C15H23N3O3/c1-21-9-8-16-15(20)11-6-7-14(17-10-11)18-12-4-2-3-5-13(12)19/h6-7,10,12-13,19H,2-5,8-9H2,1H3,(H,16,20)(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | JGOCUYIEKKVGEB-STQMWFEESA-N |
| XLogP | 1.17 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|