C17H28N4O3 — CID 95614167
6-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 95614167) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95614167 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 6-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NCCN2C[C@@H](C)O[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C17H28N4O3/c1-13-11-21(12-14(2)24-13)8-6-18-16-5-4-15(10-20-16)17(22)19-7-9-23-3/h4-5,10,13-14H,6-9,11-12H2,1-3H3,(H,18,20)(H,19,22)/t13-,14+ |
| InChIKey | ADMVGIVFUJWGTP-OKILXGFUSA-N |
| XLogP | 0.98 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|