C19H22ClN3O3 — CID 133435953
6-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 133435953) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 6-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133435953 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NC2CCCOc3c(Cl)cccc32)nc1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-25-11-9-21-19(24)13-7-8-17(22-12-13)23-16-6-3-10-26-18-14(16)4-2-5-15(18)20/h2,4-5,7-8,12,16H,3,6,9-11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | BATZDMIZMLJYMV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|