C12H17BrN2O2 — CID 122062511
2-[(5-bromo-4-methyl-2-pyridinyl)amino]-4-methylpentanoic acid (PubChem CID 122062511) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[(5-bromo-4-methyl-2-pyridinyl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(5-bromo-4-methyl-2-pyridinyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122062511 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(5-bromo-4-methyl-2-pyridinyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1cc(NC(CC(C)C)C(=O)O)ncc1Br |
| InChI | InChI=1S/C12H17BrN2O2/c1-7(2)4-10(12(16)17)15-11-5-8(3)9(13)6-14-11/h5-7,10H,4H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | SOTAFEFBXKUANJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |