C27H34N6S2 — CID 142583588
4-ethenyl-2-(1-methylpiperidin-4-yl)sulfanylpyridine;prop-1-en-2-yl N-methyl-2-(methylamino)quinazoline-7-carboximidothioate (PubChem CID 142583588) has the molecular formula C27H34N6S2 and a molecular weight of 506.75 g/mol. Its IUPAC name is 4-ethenyl-2-(1-methylpiperidin-4-yl)sulfanylpyridine;prop-1-en-2-yl N-methyl-2-(methylamino)quinazoline-7-carboximidothioate.
| Compound Name | 4-ethenyl-2-(1-methylpiperidin-4-yl)sulfanylpyridine;prop-1-en-2-yl N-methyl-2-(methylamino)quinazoline-7-carboximidothioate |
|---|---|
| PubChem CID | 142583588 |
| Molecular Formula | C27H34N6S2 |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 4-ethenyl-2-(1-methylpiperidin-4-yl)sulfanylpyridine;prop-1-en-2-yl N-methyl-2-(methylamino)quinazoline-7-carboximidothioate |
| SMILES | C=C(C)S/C(=N\C)c1ccc2cnc(NC)nc2c1.C=Cc1ccnc(SC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C14H16N4S.C13H18N2S/c1-9(2)19-13(15-3)10-5-6-11-8-17-14(16-4)18-12(11)7-10;1-3-11-4-7-14-13(10-11)16-12-5-8-15(2)9-6-12/h5-8H,1H2,2-4H3,(H,16,17,18);3-4,7,10,12H,1,5-6,8-9H2,2H3/b15-13-; |
| InChIKey | AKECBAZTUNSKPC-ZDCVYKBASA-N |
| XLogP | 6.23 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|