C28H32N6S — CID 145392125
1-[3-[1-[2-(4-cyclopropylpiperazin-1-yl)-4-pyridinyl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate (PubChem CID 145392125) has the molecular formula C28H32N6S and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[3-[1-[2-(4-cyclopropylpiperazin-1-yl)-4-pyridinyl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate.
| Compound Name | 1-[3-[1-[2-(4-cyclopropylpiperazin-1-yl)-4-pyridinyl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate |
|---|---|
| PubChem CID | 145392125 |
| Molecular Formula | C28H32N6S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1-[3-[1-[2-(4-cyclopropylpiperazin-1-yl)-4-pyridinyl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate |
| SMILES | C=C(Nc1cc2cc(C(=C)S/C(C)=N/C)ccc2cn1)c1ccnc(N2CCN(C3CC3)CC2)c1 |
| InChI | InChI=1S/C28H32N6S/c1-19(22-9-10-30-28(17-22)34-13-11-33(12-14-34)26-7-8-26)32-27-16-25-15-23(5-6-24(25)18-31-27)20(2)35-21(3)29-4/h5-6,9-10,15-18,26H,1-2,7-8,11-14H2,3-4H3,(H,31,32)/b29-21+ |
| InChIKey | LBMBVMGCKMZYPB-XHLNEMQHSA-N |
| XLogP | 5.75 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|