C23H30FN5S — CID 142563090
1-[3-[1-[(4S)-4-(dimethylamino)-3-fluoropiperidin-1-yl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate (PubChem CID 142563090) has the molecular formula C23H30FN5S and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[3-[1-[(4S)-4-(dimethylamino)-3-fluoropiperidin-1-yl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate.
| Compound Name | 1-[3-[1-[(4S)-4-(dimethylamino)-3-fluoropiperidin-1-yl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate |
|---|---|
| PubChem CID | 142563090 |
| Molecular Formula | C23H30FN5S |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[3-[1-[(4S)-4-(dimethylamino)-3-fluoropiperidin-1-yl]ethenylamino]isoquinolin-6-yl]ethenyl N-methylethanimidothioate |
| SMILES | C=C(S/C(C)=N/C)c1ccc2cnc(NC(=C)N3CC[C@H](N(C)C)C(F)C3)cc2c1 |
| InChI | InChI=1S/C23H30FN5S/c1-15(30-17(3)25-4)18-7-8-19-13-26-23(12-20(19)11-18)27-16(2)29-10-9-22(28(5)6)21(24)14-29/h7-8,11-13,21-22H,1-2,9-10,14H2,3-6H3,(H,26,27)/b25-17+/t21?,22-/m0/s1 |
| InChIKey | RKXWOVBFWQXKKH-INOXJCOKSA-N |
| XLogP | 4.84 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|