C24H31FN4O2 — CID 166702198
1-[3-[[4-fluoro-1-(2-methylpropyl)piperidine-4-carbonyl]amino]isoquinolin-6-yl]ethenyl N-methylethanimidate (PubChem CID 166702198) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-[3-[[4-fluoro-1-(2-methylpropyl)piperidine-4-carbonyl]amino]isoquinolin-6-yl]ethenyl N-methylethanimidate.
| Compound Name | 1-[3-[[4-fluoro-1-(2-methylpropyl)piperidine-4-carbonyl]amino]isoquinolin-6-yl]ethenyl N-methylethanimidate |
|---|---|
| PubChem CID | 166702198 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-[3-[[4-fluoro-1-(2-methylpropyl)piperidine-4-carbonyl]amino]isoquinolin-6-yl]ethenyl N-methylethanimidate |
| SMILES | C=C(O/C(C)=N/C)c1ccc2cnc(NC(=O)C3(F)CCN(CC(C)C)CC3)cc2c1 |
| InChI | InChI=1S/C24H31FN4O2/c1-16(2)15-29-10-8-24(25,9-11-29)23(30)28-22-13-21-12-19(6-7-20(21)14-27-22)17(3)31-18(4)26-5/h6-7,12-14,16H,3,8-11,15H2,1-2,4-5H3,(H,27,28,30)/b26-18+ |
| InChIKey | XIKQYNJDBGGLFE-NLRVBDNBSA-N |
| XLogP | 4.67 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|