C23H19FN2O2 — CID 176547335
4-(1-fluoroethoxy)-N-(6-penta-1,3,4-trien-2-ylisoquinolin-3-yl)benzamide (PubChem CID 176547335) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-(1-fluoroethoxy)-N-(6-penta-1,3,4-trien-2-ylisoquinolin-3-yl)benzamide.
| Compound Name | 4-(1-fluoroethoxy)-N-(6-penta-1,3,4-trien-2-ylisoquinolin-3-yl)benzamide |
|---|---|
| PubChem CID | 176547335 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-(1-fluoroethoxy)-N-(6-penta-1,3,4-trien-2-ylisoquinolin-3-yl)benzamide |
| SMILES | C=C=CC(=C)c1ccc2cnc(NC(=O)c3ccc(OC(C)F)cc3)cc2c1 |
| InChI | InChI=1S/C23H19FN2O2/c1-4-5-15(2)18-6-7-19-14-25-22(13-20(19)12-18)26-23(27)17-8-10-21(11-9-17)28-16(3)24/h5-14,16H,1-2H2,3H3,(H,25,26,27) |
| InChIKey | DHKSINTVTFEOTQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|