C21H17FN4O2S — CID 145392365
N-[6-(2-amino-1,3-thiazol-5-yl)isoquinolin-3-yl]-4-(1-fluoroethoxy)benzamide (PubChem CID 145392365) has the molecular formula C21H17FN4O2S and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[6-(2-amino-1,3-thiazol-5-yl)isoquinolin-3-yl]-4-(1-fluoroethoxy)benzamide.
| Compound Name | N-[6-(2-amino-1,3-thiazol-5-yl)isoquinolin-3-yl]-4-(1-fluoroethoxy)benzamide |
|---|---|
| PubChem CID | 145392365 |
| Molecular Formula | C21H17FN4O2S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[6-(2-amino-1,3-thiazol-5-yl)isoquinolin-3-yl]-4-(1-fluoroethoxy)benzamide |
| SMILES | CC(F)Oc1ccc(C(=O)Nc2cc3cc(-c4cnc(N)s4)ccc3cn2)cc1 |
| InChI | InChI=1S/C21H17FN4O2S/c1-12(22)28-17-6-4-13(5-7-17)20(27)26-19-9-16-8-14(2-3-15(16)10-24-19)18-11-25-21(23)29-18/h2-12H,1H3,(H2,23,25)(H,24,26,27) |
| InChIKey | UJDUEQWPVDNXMA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |