C28H31IN4O — CID 166787180
N-[6-[(3E)-4-iodobuta-1,3-dien-2-yl]isoquinolin-3-yl]-3-(4-methyl-1,4-diazepan-1-yl)-4-methylidenecyclohepta-1,6-diene-1-carboxamide (PubChem CID 166787180) has the molecular formula C28H31IN4O and a molecular weight of 566.49 g/mol. Its IUPAC name is N-[6-[(3E)-4-iodobuta-1,3-dien-2-yl]isoquinolin-3-yl]-3-(4-methyl-1,4-diazepan-1-yl)-4-methylidenecyclohepta-1,6-diene-1-carboxamide.
| Compound Name | N-[6-[(3E)-4-iodobuta-1,3-dien-2-yl]isoquinolin-3-yl]-3-(4-methyl-1,4-diazepan-1-yl)-4-methylidenecyclohepta-1,6-diene-1-carboxamide |
|---|---|
| PubChem CID | 166787180 |
| Molecular Formula | C28H31IN4O |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | N-[6-[(3E)-4-iodobuta-1,3-dien-2-yl]isoquinolin-3-yl]-3-(4-methyl-1,4-diazepan-1-yl)-4-methylidenecyclohepta-1,6-diene-1-carboxamide |
| SMILES | C=C(/C=C/I)c1ccc2cnc(NC(=O)C3=CC(N4CCCN(C)CC4)C(=C)CC=C3)cc2c1 |
| InChI | InChI=1S/C28H31IN4O/c1-20(10-11-29)22-8-9-24-19-30-27(18-25(24)16-22)31-28(34)23-7-4-6-21(2)26(17-23)33-13-5-12-32(3)14-15-33/h4,7-11,16-19,26H,1-2,5-6,12-15H2,3H3,(H,30,31,34)/b11-10+ |
| InChIKey | OYXNYGDDGRRCQH-ZHACJKMWSA-N |
| XLogP | 5.58 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|