C25H26N4O2S — CID 145392686
1-[3-[[3-(1-methylpiperidin-4-yl)oxybenzoyl]amino]isoquinolin-6-yl]ethenyl methanimidothioate (PubChem CID 145392686) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 1-[3-[[3-(1-methylpiperidin-4-yl)oxybenzoyl]amino]isoquinolin-6-yl]ethenyl methanimidothioate.
| Compound Name | 1-[3-[[3-(1-methylpiperidin-4-yl)oxybenzoyl]amino]isoquinolin-6-yl]ethenyl methanimidothioate |
|---|---|
| PubChem CID | 145392686 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[3-[[3-(1-methylpiperidin-4-yl)oxybenzoyl]amino]isoquinolin-6-yl]ethenyl methanimidothioate |
| SMILES | [H]/N=C/SC(=C)c1ccc2cnc(NC(=O)c3cccc(OC4CCN(C)CC4)c3)cc2c1 |
| InChI | InChI=1S/C25H26N4O2S/c1-17(32-16-26)18-6-7-20-15-27-24(14-21(20)12-18)28-25(30)19-4-3-5-23(13-19)31-22-8-10-29(2)11-9-22/h3-7,12-16,22,26H,1,8-11H2,2H3,(H,27,28,30)/b26-16+ |
| InChIKey | YLWQDQWIQPBGIU-WGOQTCKBSA-N |
| XLogP | 5.27 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|