C22H24N8OS — CID 155617577
carbamimidoyl 3-[[2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate (PubChem CID 155617577) has the molecular formula C22H24N8OS and a molecular weight of 448.56 g/mol. Its IUPAC name is carbamimidoyl 3-[[2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate.
| Compound Name | carbamimidoyl 3-[[2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate |
|---|---|
| PubChem CID | 155617577 |
| Molecular Formula | C22H24N8OS |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | carbamimidoyl 3-[[2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate |
| SMILES | [H]/N=C(\S/C(N)=N/[H])c1ccc2cnc(NC(=O)c3ccnc(N4CCN(C)CC4)c3)cc2c1 |
| InChI | InChI=1S/C22H24N8OS/c1-29-6-8-30(9-7-29)19-12-15(4-5-26-19)21(31)28-18-11-17-10-14(20(23)32-22(24)25)2-3-16(17)13-27-18/h2-5,10-13,23H,6-9H2,1H3,(H3,24,25)(H,27,28,31)/b23-20- |
| InChIKey | KGMXDXVQVFONKV-ATJXCDBQSA-N |
| XLogP | 2.59 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|