C25H33N5OS — CID 142562931
1-[3-[[4-(4-methylpiperazin-1-yl)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate (PubChem CID 142562931) has the molecular formula C25H33N5OS and a molecular weight of 451.64 g/mol. Its IUPAC name is 1-[3-[[4-(4-methylpiperazin-1-yl)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate.
| Compound Name | 1-[3-[[4-(4-methylpiperazin-1-yl)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate |
|---|---|
| PubChem CID | 142562931 |
| Molecular Formula | C25H33N5OS |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[3-[[4-(4-methylpiperazin-1-yl)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate |
| SMILES | [H]/N=C(\C)SC(=C)c1ccc2cnc(NC(=O)C3CCC(N4CCN(C)CC4)CC3)cc2c1 |
| InChI | InChI=1S/C25H33N5OS/c1-17(32-18(2)26)20-4-5-21-16-27-24(15-22(21)14-20)28-25(31)19-6-8-23(9-7-19)30-12-10-29(3)11-13-30/h4-5,14-16,19,23,26H,1,6-13H2,2-3H3,(H,27,28,31)/b26-18+ |
| InChIKey | UDRNYPFKPJSSFJ-NLRVBDNBSA-N |
| XLogP | 4.68 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|