C23H34N4O2S — CID 142563000
1-[3-[[4-(2-methoxyethylamino)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen (PubChem CID 142563000) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 1-[3-[[4-(2-methoxyethylamino)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen.
| Compound Name | 1-[3-[[4-(2-methoxyethylamino)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
|---|---|
| PubChem CID | 142563000 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-[3-[[4-(2-methoxyethylamino)cyclohexanecarbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
| SMILES | [H]/N=C(\C)SC(=C)c1ccc2cnc(NC(=O)C3CCC(NCCOC)CC3)cc2c1.[H][H].[H][H] |
| InChI | InChI=1S/C23H30N4O2S.2H2/c1-15(30-16(2)24)18-4-5-19-14-26-22(13-20(19)12-18)27-23(28)17-6-8-21(9-7-17)25-10-11-29-3;;/h4-5,12-14,17,21,24-25H,1,6-11H2,2-3H3,(H,26,27,28);2*1H/b24-16+;; |
| InChIKey | LKPYBQJRHDQUQZ-OAITZSNASA-N |
| XLogP | 5.16 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|