C19H16FN3OS — CID 166786941
[3-[(4-fluorobenzoyl)amino]isoquinolin-6-yl]methyl ethanimidothioate (PubChem CID 166786941) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is [3-[(4-fluorobenzoyl)amino]isoquinolin-6-yl]methyl ethanimidothioate.
| Compound Name | [3-[(4-fluorobenzoyl)amino]isoquinolin-6-yl]methyl ethanimidothioate |
|---|---|
| PubChem CID | 166786941 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [3-[(4-fluorobenzoyl)amino]isoquinolin-6-yl]methyl ethanimidothioate |
| SMILES | [H]/N=C(\C)SCc1ccc2cnc(NC(=O)c3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C19H16FN3OS/c1-12(21)25-11-13-2-3-15-10-22-18(9-16(15)8-13)23-19(24)14-4-6-17(20)7-5-14/h2-10,21H,11H2,1H3,(H,22,23,24)/b21-12+ |
| InChIKey | RVSSYZMXFUNMJQ-CIAFOILYSA-N |
| XLogP | 4.86 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|