C21H30FN5OS — CID 142562777
1-[3-[[4-(2-fluoroethylamino)piperidine-1-carbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen (PubChem CID 142562777) has the molecular formula C21H30FN5OS and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-[3-[[4-(2-fluoroethylamino)piperidine-1-carbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen.
| Compound Name | 1-[3-[[4-(2-fluoroethylamino)piperidine-1-carbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
|---|---|
| PubChem CID | 142562777 |
| Molecular Formula | C21H30FN5OS |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[3-[[4-(2-fluoroethylamino)piperidine-1-carbonyl]amino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
| SMILES | [H]/N=C(\C)SC(=C)c1ccc2cnc(NC(=O)N3CCC(NCCF)CC3)cc2c1.[H][H].[H][H] |
| InChI | InChI=1S/C21H26FN5OS.2H2/c1-14(29-15(2)23)16-3-4-17-13-25-20(12-18(17)11-16)26-21(28)27-9-5-19(6-10-27)24-8-7-22;;/h3-4,11-13,19,23-24H,1,5-10H2,2H3,(H,25,26,28);2*1H/b23-15+;; |
| InChIKey | UNIAIPBRAVLREP-RKIARVFCSA-N |
| XLogP | 4.98 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|