C27H33N5S — CID 145392249
1-[3-[3-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-pyridinyl]propylamino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen (PubChem CID 145392249) has the molecular formula C27H33N5S and a molecular weight of 459.66 g/mol. Its IUPAC name is 1-[3-[3-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-pyridinyl]propylamino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen.
| Compound Name | 1-[3-[3-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-pyridinyl]propylamino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
|---|---|
| PubChem CID | 145392249 |
| Molecular Formula | C27H33N5S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 1-[3-[3-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-pyridinyl]propylamino]isoquinolin-6-yl]ethenyl ethanimidothioate;molecular hydrogen |
| SMILES | [H]/N=C(\C)SC(=C)c1ccc2cnc(NCCCc3ccnc(C4=CCN(C)CC4)c3)cc2c1.[H][H] |
| InChI | InChI=1S/C27H31N5S.H2/c1-19(33-20(2)28)23-6-7-24-18-31-27(17-25(24)16-23)30-11-4-5-21-8-12-29-26(15-21)22-9-13-32(3)14-10-22;/h6-9,12,15-18,28H,1,4-5,10-11,13-14H2,2-3H3,(H,30,31);1H/b28-20+; |
| InChIKey | MPLJOGCJQCHNAX-UTGUOAKPSA-N |
| XLogP | 6.34 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|