C28H36N6 — CID 145392354
6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]propyl]isoquinolin-3-amine (PubChem CID 145392354) has the molecular formula C28H36N6 and a molecular weight of 456.64 g/mol. Its IUPAC name is 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]propyl]isoquinolin-3-amine.
| Compound Name | 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]propyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 145392354 |
| Molecular Formula | C28H36N6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]propyl]isoquinolin-3-amine |
| SMILES | C=C/C(=C\N(C)C)c1ccc2cnc(NCCCc3ccnc(N4CCN(C)CC4)c3)cc2c1 |
| InChI | InChI=1S/C28H36N6/c1-5-23(21-32(2)3)24-8-9-25-20-31-27(19-26(25)18-24)29-11-6-7-22-10-12-30-28(17-22)34-15-13-33(4)14-16-34/h5,8-10,12,17-21H,1,6-7,11,13-16H2,2-4H3,(H,29,31)/b23-21+ |
| InChIKey | GWWZDGPUTRFBLC-XTQSDGFTSA-N |
| XLogP | 4.51 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|