C27H33N7 — CID 145392531
N-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-3-amine;1-methyl-4-(4-prop-2-enyl-2-pyridinyl)piperazine (PubChem CID 145392531) has the molecular formula C27H33N7 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-3-amine;1-methyl-4-(4-prop-2-enyl-2-pyridinyl)piperazine.
| Compound Name | N-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-3-amine;1-methyl-4-(4-prop-2-enyl-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 145392531 |
| Molecular Formula | C27H33N7 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-3-amine;1-methyl-4-(4-prop-2-enyl-2-pyridinyl)piperazine |
| SMILES | C=CCc1ccnc(N2CCN(C)CC2)c1.CNc1cc2cc(-c3cnn(C)c3)ccc2cn1 |
| InChI | InChI=1S/C14H14N4.C13H19N3/c1-15-14-6-12-5-10(3-4-11(12)7-16-14)13-8-17-18(2)9-13;1-3-4-12-5-6-14-13(11-12)16-9-7-15(2)8-10-16/h3-9H,1-2H3,(H,15,16);3,5-6,11H,1,4,7-10H2,2H3 |
| InChIKey | BGRXRBXEAQUOCW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|