C22H22N4O — CID 145392347
N-[6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]isoquinolin-3-yl]-2-pyridin-4-ylacetamide (PubChem CID 145392347) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is N-[6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]isoquinolin-3-yl]-2-pyridin-4-ylacetamide.
| Compound Name | N-[6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]isoquinolin-3-yl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 145392347 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]isoquinolin-3-yl]-2-pyridin-4-ylacetamide |
| SMILES | C=C/C(=C\N(C)C)c1ccc2cnc(NC(=O)Cc3ccncc3)cc2c1 |
| InChI | InChI=1S/C22H22N4O/c1-4-17(15-26(2)3)18-5-6-19-14-24-21(13-20(19)12-18)25-22(27)11-16-7-9-23-10-8-16/h4-10,12-15H,1,11H2,2-3H3,(H,24,25,27)/b17-15+ |
| InChIKey | FVXVJOFBDYNLDV-BMRADRMJSA-N |
| XLogP | 3.90 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|