C21H30N6 — CID 166954824
6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-ethylpiperidin-4-yl)ethenyl]isoquinolin-3-amine (PubChem CID 166954824) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-ethylpiperidin-4-yl)ethenyl]isoquinolin-3-amine.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-ethylpiperidin-4-yl)ethenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 166954824 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-ethylpiperidin-4-yl)ethenyl]isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(/C(N)=C/N(C)N)ccc2cn1)C1CCN(CC)CC1 |
| InChI | InChI=1S/C21H30N6/c1-4-27-9-7-16(8-10-27)15(2)25-21-12-19-11-17(20(22)14-26(3)23)5-6-18(19)13-24-21/h5-6,11-14,16H,2,4,7-10,22-23H2,1,3H3,(H,24,25)/b20-14- |
| InChIKey | MBJIKCNTTOCXAV-ZHZULCJRSA-N |
| XLogP | 2.95 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|