C22H32N6 — CID 166954348
6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-propylpiperidin-4-yl)ethenyl]isoquinolin-3-amine (PubChem CID 166954348) has the molecular formula C22H32N6 and a molecular weight of 380.54 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-propylpiperidin-4-yl)ethenyl]isoquinolin-3-amine.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-propylpiperidin-4-yl)ethenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 166954348 |
| Molecular Formula | C22H32N6 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-(1-propylpiperidin-4-yl)ethenyl]isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(/C(N)=C/N(C)N)ccc2cn1)C1CCN(CCC)CC1 |
| InChI | InChI=1S/C22H32N6/c1-4-9-28-10-7-17(8-11-28)16(2)26-22-13-20-12-18(21(23)15-27(3)24)5-6-19(20)14-25-22/h5-6,12-15,17H,2,4,7-11,23-24H2,1,3H3,(H,25,26)/b21-15- |
| InChIKey | DTTHNEWCCIUGGD-QNGOZBTKSA-N |
| XLogP | 3.35 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|