C24H34N6O — CID 166702135
6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[1-(oxan-4-yl)piperidin-4-yl]ethenyl]isoquinolin-3-amine (PubChem CID 166702135) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[1-(oxan-4-yl)piperidin-4-yl]ethenyl]isoquinolin-3-amine.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[1-(oxan-4-yl)piperidin-4-yl]ethenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 166702135 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[1-(oxan-4-yl)piperidin-4-yl]ethenyl]isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(/C(N)=C/N(C)N)ccc2cn1)C1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C24H34N6O/c1-17(18-5-9-30(10-6-18)22-7-11-31-12-8-22)28-24-14-21-13-19(23(25)16-29(2)26)3-4-20(21)15-27-24/h3-4,13-16,18,22H,1,5-12,25-26H2,2H3,(H,27,28)/b23-16- |
| InChIKey | OBFTZCRLGMKXQX-KQWNVCNZSA-N |
| XLogP | 3.11 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|