C19H26N6O2 — CID 166702158
N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-2-(4-methylmorpholin-2-yl)acetamide (PubChem CID 166702158) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-2-(4-methylmorpholin-2-yl)acetamide.
| Compound Name | N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-2-(4-methylmorpholin-2-yl)acetamide |
|---|---|
| PubChem CID | 166702158 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-2-(4-methylmorpholin-2-yl)acetamide |
| SMILES | CN(N)/C=C(\N)c1ccc2cnc(NC(=O)CC3CN(C)CCO3)cc2c1 |
| InChI | InChI=1S/C19H26N6O2/c1-24-5-6-27-16(11-24)9-19(26)23-18-8-15-7-13(17(20)12-25(2)21)3-4-14(15)10-22-18/h3-4,7-8,10,12,16H,5-6,9,11,20-21H2,1-2H3,(H,22,23,26)/b17-12- |
| InChIKey | VWYPZBKXLXGWMC-ATVHPVEESA-N |
| XLogP | 0.96 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|