C25H31N5 — CID 145392625
6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[4-(2-methylpropyl)phenyl]prop-1-enyl]isoquinolin-3-amine (PubChem CID 145392625) has the molecular formula C25H31N5 and a molecular weight of 401.56 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[4-(2-methylpropyl)phenyl]prop-1-enyl]isoquinolin-3-amine.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[4-(2-methylpropyl)phenyl]prop-1-enyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 145392625 |
| Molecular Formula | C25H31N5 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-N-[1-[4-(2-methylpropyl)phenyl]prop-1-enyl]isoquinolin-3-amine |
| SMILES | CC=C(Nc1cc2cc(/C(N)=C/N(C)N)ccc2cn1)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C25H31N5/c1-5-24(19-8-6-18(7-9-19)12-17(2)3)29-25-14-22-13-20(23(26)16-30(4)27)10-11-21(22)15-28-25/h5-11,13-17H,12,26-27H2,1-4H3,(H,28,29)/b23-16-,24-5? |
| InChIKey | OTLNFALWCQIQGN-JETJVVDUSA-N |
| XLogP | 4.97 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|