C22H32N6O — CID 166702389
N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-1-(2-methylpropyl)piperidine-4-carboxamide (PubChem CID 166702389) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-1-(2-methylpropyl)piperidine-4-carboxamide.
| Compound Name | N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-1-(2-methylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166702389 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | N-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]isoquinolin-3-yl]-1-(2-methylpropyl)piperidine-4-carboxamide |
| SMILES | CC(C)CN1CCC(C(=O)Nc2cc3cc(/C(N)=C/N(C)N)ccc3cn2)CC1 |
| InChI | InChI=1S/C22H32N6O/c1-15(2)13-28-8-6-16(7-9-28)22(29)26-21-11-19-10-17(20(23)14-27(3)24)4-5-18(19)12-25-21/h4-5,10-12,14-16H,6-9,13,23-24H2,1-3H3,(H,25,26,29)/b20-14- |
| InChIKey | FXROPLRINJDFNE-ZHZULCJRSA-N |
| XLogP | 2.60 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|