C28H31N3 — CID 145392240
6-[(3E)-penta-1,3-dien-3-yl]-N-[1-[3-(piperidin-4-ylmethyl)phenyl]ethenyl]isoquinolin-3-amine (PubChem CID 145392240) has the molecular formula C28H31N3 and a molecular weight of 409.58 g/mol. Its IUPAC name is 6-[(3E)-penta-1,3-dien-3-yl]-N-[1-[3-(piperidin-4-ylmethyl)phenyl]ethenyl]isoquinolin-3-amine.
| Compound Name | 6-[(3E)-penta-1,3-dien-3-yl]-N-[1-[3-(piperidin-4-ylmethyl)phenyl]ethenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 145392240 |
| Molecular Formula | C28H31N3 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 6-[(3E)-penta-1,3-dien-3-yl]-N-[1-[3-(piperidin-4-ylmethyl)phenyl]ethenyl]isoquinolin-3-amine |
| SMILES | C=C/C(=C\C)c1ccc2cnc(NC(=C)c3cccc(CC4CCNCC4)c3)cc2c1 |
| InChI | InChI=1S/C28H31N3/c1-4-23(5-2)25-9-10-26-19-30-28(18-27(26)17-25)31-20(3)24-8-6-7-22(16-24)15-21-11-13-29-14-12-21/h4-10,16-19,21,29H,1,3,11-15H2,2H3,(H,30,31)/b23-5+ |
| InChIKey | YXYRSDYHLQRGPE-MUDSWDHVSA-N |
| XLogP | 6.45 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|